Products 2247103-84-8

CAS 2247103-84-8 is the registry number for 4-Methanesulfonylfuran-2-carboxylic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.

Structural formula: {0} (CAS {1})

4-methylsulfonylfuran-2-carboxylic acid (CAS 2247103-84-8) is a chemical compound with the molecular formula C6H6O5S and a molecular weight of 190.18 g/mol. IUPAC name: 4-methylsulfonylfuran-2-carboxylic acid. InChIKey: LGPDRWIUVXLRAM-UHFFFAOYSA-N.

Identity
Molecular formulaC6H6O5S
Molecular weight190.18 g/mol
IUPAC name4-methylsulfonylfuran-2-carboxylic acid
InChIKeyLGPDRWIUVXLRAM-UHFFFAOYSA-N
SMILESCS(=O)(=O)C1=COC(=C1)C(=O)O

Computed by PubChem (NCBI)