CAS 1520606-32-9 appears in our catalog under these names: 5-Methanesulfonylfuran-3-carboxylic acid, 95%, 5-Methanesulfonylfuran-3-carboxylic acid, 5-Methanesulfonylfuran-3-carboxylic acid 95%, 5-Methanesulfonylfuran-3-carboxylic acid, 95%, 95%. Offered by: AmBeed, Biosynth, Chemat. Available pack sizes: 1g, 0,5g, 50mg, 100mg.
5-methylsulfonylfuran-3-carboxylic acid (CAS 1520606-32-9) is a chemical compound with the molecular formula C6H6O5S and a molecular weight of 190.18 g/mol. IUPAC name: 5-methylsulfonylfuran-3-carboxylic acid. InChIKey: SLNQKUYTZDEGHA-UHFFFAOYSA-N.
| Molecular formula | C6H6O5S |
|---|---|
| Molecular weight | 190.18 g/mol |
| IUPAC name | 5-methylsulfonylfuran-3-carboxylic acid |
| InChIKey | SLNQKUYTZDEGHA-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)C1=CC(=CO1)C(=O)O |
Computed by PubChem (NCBI)