Products 23423-91-8
CAS 23423-91-8 appears in our catalog under these names: 5–Methanesulfonylfuran–2–carboxylic acid, 5-Methanesulfonylfuran-2-carboxylic acid, 5-Methanesulfonylfuran-2-carboxylic acid 95%, 5-Methanesulfonylfuran-2-carboxylic acid, 95%, 95%, 5-METHANESULFONYLFURAN-2-CARBOXYLIC ACID, 98%. Offered by: GLPBio, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 2,5g, 25g, 1g, 5g.
5-methylsulfonylfuran-2-carboxylic acid (CAS 23423-91-8) is a chemical compound with the molecular formula C6H6O5S and a molecular weight of 190.18 g/mol. IUPAC name: 5-methylsulfonylfuran-2-carboxylic acid. InChIKey: ZREDSSGHFVMCQP-UHFFFAOYSA-N.
| Molecular formula | C6H6O5S |
|---|---|
| Molecular weight | 190.18 g/mol |
| IUPAC name | 5-methylsulfonylfuran-2-carboxylic acid |
| InChIKey | ZREDSSGHFVMCQP-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)C1=CC=C(O1)C(=O)O |
Computed by PubChem (NCBI)