cas: 29735-88-4 — see every product listed under this CAS number, including other names
5-Methoxy-2-methyl-benzofuran-3-carboxylic acid (CAS 29735-88-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F055632-100MG |
| cas | 29735-88-4 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 1611.95 Pln | |
| Fluorochem | 250mg | 2044.09 Pln | |
| Fluorochem | 1g | 3512.32 Pln |
| delivery time | 2-3 weeks |
|---|
5-methoxy-2-methyl-1-benzofuran-3-carboxylic acid (CAS 29735-88-4) is a chemical compound with the molecular formula C11H10O4 and a molecular weight of 206.19 g/mol. IUPAC name: 5-methoxy-2-methyl-1-benzofuran-3-carboxylic acid. InChIKey: RSHSSGDUMLTSEG-UHFFFAOYSA-N.
| Molecular formula | C11H10O4 |
|---|---|
| Molecular weight | 206.19 g/mol |
| IUPAC name | 5-methoxy-2-methyl-1-benzofuran-3-carboxylic acid |
| InChIKey | RSHSSGDUMLTSEG-UHFFFAOYSA-N |
| SMILES | CC1=C(C2=C(O1)C=CC(=C2)OC)C(=O)O |
Computed by PubChem (NCBI)