cas: 69397-93-9 — see every product listed under this CAS number, including other names
5-Methoxy-N-methyl-2-nitrobenzenamine, 95%, 95% (CAS 69397-93-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11FD84-250mg |
| cas | 69397-93-9 |
| size | 250mg |
| availability | 5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 93.20 Pln | |
| Chemat | 1g | 165.20 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
5-methoxy-N-methyl-2-nitroaniline (CAS 69397-93-9) is a chemical compound with the molecular formula C8H10N2O3 and a molecular weight of 182.18 g/mol. IUPAC name: 5-methoxy-N-methyl-2-nitroaniline. InChIKey: YRBBCZYRHITZDJ-UHFFFAOYSA-N.
| Molecular formula | C8H10N2O3 |
|---|---|
| Molecular weight | 182.18 g/mol |
| IUPAC name | 5-methoxy-N-methyl-2-nitroaniline |
| InChIKey | YRBBCZYRHITZDJ-UHFFFAOYSA-N |
| SMILES | CNC1=C(C=CC(=C1)OC)[N+](=O)[O-] |
Computed by PubChem (NCBI)