cas: 16459-47-5 — see every product listed under this CAS number, including other names
5-Methyl-2-(4-nitrophenyl)-2H-pyrazol-3-ylamine (CAS 16459-47-5) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 500mg. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F005967-250MG |
| cas | 16459-47-5 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 1408.90 Pln | |
| Fluorochem | 500mg | 2497.06 Pln |
| delivery time | 2-3 weeks |
|---|
5-methyl-2-(4-nitrophenyl)pyrazol-3-amine (CAS 16459-47-5) is a chemical compound with the molecular formula C10H10N4O2 and a molecular weight of 218.21 g/mol. IUPAC name: 5-methyl-2-(4-nitrophenyl)pyrazol-3-amine. InChIKey: TVXCGEBTCKIPNH-UHFFFAOYSA-N.
| Molecular formula | C10H10N4O2 |
|---|---|
| Molecular weight | 218.21 g/mol |
| IUPAC name | 5-methyl-2-(4-nitrophenyl)pyrazol-3-amine |
| InChIKey | TVXCGEBTCKIPNH-UHFFFAOYSA-N |
| SMILES | CC1=NN(C(=C1)N)C2=CC=C(C=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)