CAS 39263-34-8 is the registry number for N'-(2-Cyano-4-nitrophenyl)-n,n-dimethyliminoformamide, 95%. Offered by: Combi-blocks. Available pack sizes: 100mg, 5g, 10g, 250mg, 1g.
N'-(2-cyano-4-nitrophenyl)-N,N-dimethylmethanimidamide (CAS 39263-34-8) is a chemical compound with the molecular formula C10H10N4O2 and a molecular weight of 218.21 g/mol. IUPAC name: N'-(2-cyano-4-nitrophenyl)-N,N-dimethylmethanimidamide. InChIKey: RLSZPRPVHOOMBN-UHFFFAOYSA-N.
| Molecular formula | C10H10N4O2 |
|---|---|
| Molecular weight | 218.21 g/mol |
| IUPAC name | N'-(2-cyano-4-nitrophenyl)-N,N-dimethylmethanimidamide |
| InChIKey | RLSZPRPVHOOMBN-UHFFFAOYSA-N |
| SMILES | CN(C)C=NC1=C(C=C(C=C1)[N+](=O)[O-])C#N |
Computed by PubChem (NCBI)