CAS 25784-56-9 appears in our catalog under these names: 5-Amino-1-benzyl-1h-1,2,3-triazole-4-carboxylic acid, 95%, 5-Amino-1-benzyl-1H-1,2,3-triazole-4-carboxylic acid, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 250mg, 1g.
5-amino-1-benzyltriazole-4-carboxylic acid (CAS 25784-56-9) is a chemical compound with the molecular formula C10H10N4O2 and a molecular weight of 218.21 g/mol. IUPAC name: 5-amino-1-benzyltriazole-4-carboxylic acid. InChIKey: BKIMAZAMIHCYRZ-UHFFFAOYSA-N.
| Molecular formula | C10H10N4O2 |
|---|---|
| Molecular weight | 218.21 g/mol |
| IUPAC name | 5-amino-1-benzyltriazole-4-carboxylic acid |
| InChIKey | BKIMAZAMIHCYRZ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CN2C(=C(N=N2)C(=O)O)N |
Computed by PubChem (NCBI)