CAS 16459-47-5 appears in our catalog under these names: 5-Methyl-2-(4-nitrophenyl)-2h-pyrazol-3-ylamine, 98%, 5-Methyl-2-(4-nitrophenyl)-2H-pyrazol-3-ylamine. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 5g, 1g, 250mg, 500mg.
5-methyl-2-(4-nitrophenyl)pyrazol-3-amine (CAS 16459-47-5) is a chemical compound with the molecular formula C10H10N4O2 and a molecular weight of 218.21 g/mol. IUPAC name: 5-methyl-2-(4-nitrophenyl)pyrazol-3-amine. InChIKey: TVXCGEBTCKIPNH-UHFFFAOYSA-N.
| Molecular formula | C10H10N4O2 |
|---|---|
| Molecular weight | 218.21 g/mol |
| IUPAC name | 5-methyl-2-(4-nitrophenyl)pyrazol-3-amine |
| InChIKey | TVXCGEBTCKIPNH-UHFFFAOYSA-N |
| SMILES | CC1=NN(C(=C1)N)C2=CC=C(C=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)