CAS 31771-58-1 is the registry number for Methyl 5-amino-1-phenyl-1h-1,2,3-triazole-4-carboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 10g, 25g, 1g, 5g.
Methyl 5-amino-1-phenyltriazole-4-carboxylate (CAS 31771-58-1) is a chemical compound with the molecular formula C10H10N4O2 and a molecular weight of 218.21 g/mol. IUPAC name: methyl 5-amino-1-phenyltriazole-4-carboxylate. InChIKey: XELSIYWNEIGXMY-UHFFFAOYSA-N.
| Molecular formula | C10H10N4O2 |
|---|---|
| Molecular weight | 218.21 g/mol |
| IUPAC name | methyl 5-amino-1-phenyltriazole-4-carboxylate |
| InChIKey | XELSIYWNEIGXMY-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(N(N=N1)C2=CC=CC=C2)N |
Computed by PubChem (NCBI)