Products 31771-58-1

CAS 31771-58-1 is the registry number for Methyl 5-amino-1-phenyl-1h-1,2,3-triazole-4-carboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 10g, 25g, 1g, 5g.

Structural formula: {0} (CAS {1})

Methyl 5-amino-1-phenyltriazole-4-carboxylate (CAS 31771-58-1) is a chemical compound with the molecular formula C10H10N4O2 and a molecular weight of 218.21 g/mol. IUPAC name: methyl 5-amino-1-phenyltriazole-4-carboxylate. InChIKey: XELSIYWNEIGXMY-UHFFFAOYSA-N.

Identity
Molecular formulaC10H10N4O2
Molecular weight218.21 g/mol
IUPAC namemethyl 5-amino-1-phenyltriazole-4-carboxylate
InChIKeyXELSIYWNEIGXMY-UHFFFAOYSA-N
SMILESCOC(=O)C1=C(N(N=N1)C2=CC=CC=C2)N

Computed by PubChem (NCBI)