CAS 99072-87-4 appears in our catalog under these names: 3-Methyl-4-oxo-3,4-dihydrophthalazine-1-carbohydrazide, 3-Methyl-4-oxo-3,4-dihydro-phthalazine-1-carboxylic acid hydrazide, 95%. Offered by: Biosynth, Combi-blocks. Available pack sizes: 0,5g, 5g, 10g, 1g, 250mg.
3-methyl-4-oxophthalazine-1-carbohydrazide (CAS 99072-87-4) is a chemical compound with the molecular formula C10H10N4O2 and a molecular weight of 218.21 g/mol. IUPAC name: 3-methyl-4-oxophthalazine-1-carbohydrazide. InChIKey: SECNNFONKGVTDA-UHFFFAOYSA-N.
| Molecular formula | C10H10N4O2 |
|---|---|
| Molecular weight | 218.21 g/mol |
| IUPAC name | 3-methyl-4-oxophthalazine-1-carbohydrazide |
| InChIKey | SECNNFONKGVTDA-UHFFFAOYSA-N |
| SMILES | CN1C(=O)C2=CC=CC=C2C(=N1)C(=O)NN |
Computed by PubChem (NCBI)