cas: 850628-76-1 — see every product listed under this CAS number, including other names
5-Methyl-2-(methylthio)pyrido(2,3-d)pyrimidin-7(8H)-one, 97% (CAS 850628-76-1) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 5g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A821072-50mg |
| cas | 850628-76-1 |
| size | 50mg |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 50mg | 877.24 Pln | |
| AmBeed | 5g | 19300.54 Pln |
| purity | 97% |
|---|---|
| delivery time | To be confirmed by Chemat |
5-methyl-2-methylsulfanyl-8H-pyrido[2,3-d]pyrimidin-7-one (CAS 850628-76-1) is a chemical compound with the molecular formula C9H9N3OS and a molecular weight of 207.25 g/mol. IUPAC name: 5-methyl-2-methylsulfanyl-8H-pyrido[2,3-d]pyrimidin-7-one. InChIKey: PDPYQIHQFJOCBV-UHFFFAOYSA-N.
| Molecular formula | C9H9N3OS |
|---|---|
| Molecular weight | 207.25 g/mol |
| IUPAC name | 5-methyl-2-methylsulfanyl-8H-pyrido[2,3-d]pyrimidin-7-one |
| InChIKey | PDPYQIHQFJOCBV-UHFFFAOYSA-N |
| SMILES | CC1=CC(=O)NC2=NC(=NC=C12)SC |
Computed by PubChem (NCBI)