CAS 850628-76-1 appears in our catalog under these names: 5-Methyl-2-(methylthio)pyrido[2,3-d]pyrimidin-7(8h)-one, 95%, 5-Methyl-2-(methylthio)pyrido(2,3-d)pyrimidin-7(8H)-one, 97%, 5-Methyl-2-(methylthio)pyrido[2,3-d]pyrimidin-7(8H)-one, 97%, 97%, 5-METHYL-2-(METHYLTHIO)PYRIDO[2,3-D]PYRIMIDIN-7(8H)-ONE, 97%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 50mg, 5g, 500mg.
5-methyl-2-methylsulfanyl-8H-pyrido[2,3-d]pyrimidin-7-one (CAS 850628-76-1) is a chemical compound with the molecular formula C9H9N3OS and a molecular weight of 207.25 g/mol. IUPAC name: 5-methyl-2-methylsulfanyl-8H-pyrido[2,3-d]pyrimidin-7-one. InChIKey: PDPYQIHQFJOCBV-UHFFFAOYSA-N.
| Molecular formula | C9H9N3OS |
|---|---|
| Molecular weight | 207.25 g/mol |
| IUPAC name | 5-methyl-2-methylsulfanyl-8H-pyrido[2,3-d]pyrimidin-7-one |
| InChIKey | PDPYQIHQFJOCBV-UHFFFAOYSA-N |
| SMILES | CC1=CC(=O)NC2=NC(=NC=C12)SC |
Computed by PubChem (NCBI)