CAS 121068-32-4 appears in our catalog under these names: 5-(Phenoxymethyl)-1,3,4-thiadiazol-2-amine, 95%, 5-(Phenoxymethyl)-1,3,4-thiadiazol-2-amine 95%, 5-(Phenoxymethyl)-1,3,4-thiadiazol-2-amine, 98%, 98%, 5-Phenoxymethyl-[1,3,4]thiadiazol-2-ylamine, 98%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 250mg, 100mg, 50mg, 500mg.
5-(phenoxymethyl)-1,3,4-thiadiazol-2-amine (CAS 121068-32-4) is a chemical compound with the molecular formula C9H9N3OS and a molecular weight of 207.25 g/mol. IUPAC name: 5-(phenoxymethyl)-1,3,4-thiadiazol-2-amine. InChIKey: CLQBSPRBHILXIC-UHFFFAOYSA-N.
| Molecular formula | C9H9N3OS |
|---|---|
| Molecular weight | 207.25 g/mol |
| IUPAC name | 5-(phenoxymethyl)-1,3,4-thiadiazol-2-amine |
| InChIKey | CLQBSPRBHILXIC-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)OCC2=NN=C(S2)N |
Computed by PubChem (NCBI)