Products 846036-77-9
CAS 846036-77-9 appears in our catalog under these names: 2-(Methylthio)-4-methyl-8h-pyrido[2,3-d]pyrimidin-7-one, 95%, 4-Methyl-2-(methylthio)pyrido(2,3-d)pyrimidin-7(8H)-one, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 100mg, 5g, 10g, 250mg, 1g.
4-methyl-2-methylsulfanyl-8H-pyrido[2,3-d]pyrimidin-7-one (CAS 846036-77-9) is a chemical compound with the molecular formula C9H9N3OS and a molecular weight of 207.25 g/mol. IUPAC name: 4-methyl-2-methylsulfanyl-8H-pyrido[2,3-d]pyrimidin-7-one. InChIKey: QELLOHDXPWBISF-UHFFFAOYSA-N.
| Molecular formula | C9H9N3OS |
|---|---|
| Molecular weight | 207.25 g/mol |
| IUPAC name | 4-methyl-2-methylsulfanyl-8H-pyrido[2,3-d]pyrimidin-7-one |
| InChIKey | QELLOHDXPWBISF-UHFFFAOYSA-N |
| SMILES | CC1=C2C=CC(=O)NC2=NC(=N1)SC |
Computed by PubChem (NCBI)