CAS 38359-86-3 is the registry number for 5,6,7,8-Tetrahydro[1]benzothieno[2,3-d][1,2,3]triazin-4(3h)-one, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 10g, 250mg, 1g, 100mg.
5,6,7,8-tetrahydro-3H-[1]benzothiolo[2,3-d]triazin-4-one (CAS 38359-86-3) is a chemical compound with the molecular formula C9H9N3OS and a molecular weight of 207.25 g/mol. IUPAC name: 5,6,7,8-tetrahydro-3H-[1]benzothiolo[2,3-d]triazin-4-one. InChIKey: GTRWBCRNNYLZNQ-UHFFFAOYSA-N.
| Molecular formula | C9H9N3OS |
|---|---|
| Molecular weight | 207.25 g/mol |
| IUPAC name | 5,6,7,8-tetrahydro-3H-[1]benzothiolo[2,3-d]triazin-4-one |
| InChIKey | GTRWBCRNNYLZNQ-UHFFFAOYSA-N |
| SMILES | C1CCC2=C(C1)C3=C(S2)N=NNC3=O |
Computed by PubChem (NCBI)