CAS 49600-56-8 is the registry number for 2-Mercapto-5,7-dimethyl-pyrido[2,3-d]pyrimidin-4-ol, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 10g, 1g.
5,7-dimethyl-2-sulfanylidene-1H-pyrido[2,3-d]pyrimidin-4-one (CAS 49600-56-8) is a chemical compound with the molecular formula C9H9N3OS and a molecular weight of 207.25 g/mol. IUPAC name: 5,7-dimethyl-2-sulfanylidene-1H-pyrido[2,3-d]pyrimidin-4-one. InChIKey: BPJWGHJLUSXUFE-UHFFFAOYSA-N.
| Molecular formula | C9H9N3OS |
|---|---|
| Molecular weight | 207.25 g/mol |
| IUPAC name | 5,7-dimethyl-2-sulfanylidene-1H-pyrido[2,3-d]pyrimidin-4-one |
| InChIKey | BPJWGHJLUSXUFE-UHFFFAOYSA-N |
| SMILES | CC1=CC(=NC2=C1C(=O)NC(=S)N2)C |
Computed by PubChem (NCBI)