cas: 1186501-72-3 — see every product listed under this CAS number, including other names
5-NITRO-3-(TRIFLUOROMETHYL)-1H-PYRROLO[2,3-B]PYRIDINE, 97% (CAS 1186501-72-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F503289-100MG |
| cas | 1186501-72-3 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 1278.73 Pln | |
| Fluorochem | 250mg | 2090.95 Pln | |
| Fluorochem | 500mg | 2965.64 Pln | |
| Fluorochem | 1g | 4392.22 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
5-nitro-3-(trifluoromethyl)-1H-pyrrolo[2,3-b]pyridine (CAS 1186501-72-3) is a chemical compound with the molecular formula C8H4F3N3O2 and a molecular weight of 231.13 g/mol. IUPAC name: 5-nitro-3-(trifluoromethyl)-1H-pyrrolo[2,3-b]pyridine. InChIKey: BAFLUKHMOURLCD-UHFFFAOYSA-N.
| Molecular formula | C8H4F3N3O2 |
|---|---|
| Molecular weight | 231.13 g/mol |
| IUPAC name | 5-nitro-3-(trifluoromethyl)-1H-pyrrolo[2,3-b]pyridine |
| InChIKey | BAFLUKHMOURLCD-UHFFFAOYSA-N |
| SMILES | C1=C(C=NC2=C1C(=CN2)C(F)(F)F)[N+](=O)[O-] |
Computed by PubChem (NCBI)