cas: 39835-28-4 — see every product listed under this CAS number, including other names
5-Nitro-1,2-benzisoxazole 97% (CAS 39835-28-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A132199-100mg |
| cas | 39835-28-4 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 120.06 Pln | |
| Ambeed | 250mg | 170.12 Pln | |
| Ambeed | 1g | 381.50 Pln | |
| Ambeed | 5g | 1538.50 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A132199 |
5-nitro-1,2-benzoxazole (CAS 39835-28-4) is a chemical compound with the molecular formula C7H4N2O3 and a molecular weight of 164.12 g/mol. IUPAC name: 5-nitro-1,2-benzoxazole. InChIKey: TWOYWCWKYDYTIP-UHFFFAOYSA-N.
| Molecular formula | C7H4N2O3 |
|---|---|
| Molecular weight | 164.12 g/mol |
| IUPAC name | 5-nitro-1,2-benzoxazole |
| InChIKey | TWOYWCWKYDYTIP-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1[N+](=O)[O-])C=NO2 |
Computed by PubChem (NCBI)