cas: 39835-28-4 — see every product listed under this CAS number, including other names
5-Nitro-1,2-benzisoxazole, 97%, 97% (CAS 39835-28-4) is a chemical reagent available from Chemat. Available pack sizes: 1g, 100mg, 250mg, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11C7A1-1g |
| cas | 39835-28-4 |
| size | 1g |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 290.00 Pln | |
| Chemat | 100mg | 88.40 Pln | |
| Chemat | 250mg | 122.00 Pln | |
| Chemat | 5g | 1182.80 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
5-nitro-1,2-benzoxazole (CAS 39835-28-4) is a chemical compound with the molecular formula C7H4N2O3 and a molecular weight of 164.12 g/mol. IUPAC name: 5-nitro-1,2-benzoxazole. InChIKey: TWOYWCWKYDYTIP-UHFFFAOYSA-N.
| Molecular formula | C7H4N2O3 |
|---|---|
| Molecular weight | 164.12 g/mol |
| IUPAC name | 5-nitro-1,2-benzoxazole |
| InChIKey | TWOYWCWKYDYTIP-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1[N+](=O)[O-])C=NO2 |
Computed by PubChem (NCBI)