cas: 351990-51-7 — see every product listed under this CAS number, including other names
5-Nitro-1H-imidazole-2-carboxylic acid 95% (CAS 351990-51-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A340892-100mg |
| cas | 351990-51-7 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 292.50 Pln | |
| Ambeed | 250mg | 442.69 Pln | |
| Ambeed | 1g | 1010.06 Pln | |
| Ambeed | 5g | 3585.50 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A340892 |
5-nitro-1H-imidazole-2-carboxylic acid (CAS 351990-51-7) is a chemical compound with the molecular formula C4H3N3O4 and a molecular weight of 157.08 g/mol. IUPAC name: 5-nitro-1H-imidazole-2-carboxylic acid. InChIKey: LNPSXTPPQBEISL-UHFFFAOYSA-N.
| Molecular formula | C4H3N3O4 |
|---|---|
| Molecular weight | 157.08 g/mol |
| IUPAC name | 5-nitro-1H-imidazole-2-carboxylic acid |
| InChIKey | LNPSXTPPQBEISL-UHFFFAOYSA-N |
| SMILES | C1=C(NC(=N1)C(=O)O)[N+](=O)[O-] |
Computed by PubChem (NCBI)