cas: 1427359-47-4 — see every product listed under this CAS number, including other names
5-Oxa-2-azaspiro[3.5]nonane oxalate, 97% (CAS 1427359-47-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1140TL-100mg |
| cas | 1427359-47-4 |
| size | 100mg |
| availability | 25g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 712.40 Pln | |
| Chemat | 250mg | 899.60 Pln | |
| Chemat | 500mg | 1269.20 Pln | |
| Chemat | 1g | 2291.60 Pln | |
| Chemat | 5g | 6558.80 Pln | |
| Chemat | 10g | 11205.20 Pln | |
| Chemat | 25g | 18630.80 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
5-oxa-2-azaspiro[3.5]nonane;oxalic acid (CAS 1427359-47-4) is a chemical compound with the molecular formula C9H15NO5 and a molecular weight of 217.22 g/mol. IUPAC name: 5-oxa-2-azaspiro[3.5]nonane;oxalic acid. InChIKey: YCPQYPIJYODIKC-UHFFFAOYSA-N.
| Molecular formula | C9H15NO5 |
|---|---|
| Molecular weight | 217.22 g/mol |
| IUPAC name | 5-oxa-2-azaspiro[3.5]nonane;oxalic acid |
| InChIKey | YCPQYPIJYODIKC-UHFFFAOYSA-N |
| SMILES | C1CCOC2(C1)CNC2.C(=O)(C(=O)O)O |
Computed by PubChem (NCBI)