CAS 1159736-25-0 appears in our catalog under these names: 3-((tert-Butoxycarbonyl)amino)oxetane-3-carboxylic acid, 95%, 3–((tert–Butoxycarbonyl)amino)oxetane–3–carboxylic acid, 3-((tert-Butoxycarbonyl)amino)oxetane-3-carboxylic acid 95%, 3-((tert-Butoxycarbonyl)amino)oxetane-3-carboxylic acid, 97%, 97%, 3-(BOC-AMINO)OXETANE-3-CARBOXYLIC ACID, 97%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 250mg, 100mg, 500mg, 10g.
3-[(2-methylpropan-2-yl)oxycarbonylamino]oxetane-3-carboxylic acid (CAS 1159736-25-0) is a chemical compound with the molecular formula C9H15NO5 and a molecular weight of 217.22 g/mol. IUPAC name: 3-[(2-methylpropan-2-yl)oxycarbonylamino]oxetane-3-carboxylic acid. InChIKey: IIINBAWOESLQTR-UHFFFAOYSA-N.
| Molecular formula | C9H15NO5 |
|---|---|
| Molecular weight | 217.22 g/mol |
| IUPAC name | 3-[(2-methylpropan-2-yl)oxycarbonylamino]oxetane-3-carboxylic acid |
| InChIKey | IIINBAWOESLQTR-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1(COC1)C(=O)O |
Computed by PubChem (NCBI)