CAS 1427359-47-4 appears in our catalog under these names: 5-Oxa-2-aza-spiro[3.5]nonane oxalate, 95%, 5-Oxa-2-azaspiro[3.5]nonane oxalate, 97%, 97%. Offered by: Combi-blocks, Chemat. Available pack sizes: 500mg, 25g, 100mg, 250mg, 1g, 5g, 10g.
5-oxa-2-azaspiro[3.5]nonane;oxalic acid (CAS 1427359-47-4) is a chemical compound with the molecular formula C9H15NO5 and a molecular weight of 217.22 g/mol. IUPAC name: 5-oxa-2-azaspiro[3.5]nonane;oxalic acid. InChIKey: YCPQYPIJYODIKC-UHFFFAOYSA-N.
| Molecular formula | C9H15NO5 |
|---|---|
| Molecular weight | 217.22 g/mol |
| IUPAC name | 5-oxa-2-azaspiro[3.5]nonane;oxalic acid |
| InChIKey | YCPQYPIJYODIKC-UHFFFAOYSA-N |
| SMILES | C1CCOC2(C1)CNC2.C(=O)(C(=O)O)O |
Computed by PubChem (NCBI)