Products 2168238-83-1

CAS 2168238-83-1 is the registry number for N-Carboxymethyl-2,2-dimethyl-succinamic acid methyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

2-[(4-methoxy-3,3-dimethyl-4-oxobutanoyl)amino]acetic acid (CAS 2168238-83-1) is a chemical compound with the molecular formula C9H15NO5 and a molecular weight of 217.22 g/mol. IUPAC name: 2-[(4-methoxy-3,3-dimethyl-4-oxobutanoyl)amino]acetic acid. InChIKey: UUXUMGRSIDDGBZ-UHFFFAOYSA-N.

Identity
Molecular formulaC9H15NO5
Molecular weight217.22 g/mol
IUPAC name2-[(4-methoxy-3,3-dimethyl-4-oxobutanoyl)amino]acetic acid
InChIKeyUUXUMGRSIDDGBZ-UHFFFAOYSA-N
SMILESCC(C)(CC(=O)NCC(=O)O)C(=O)OC

Computed by PubChem (NCBI)