CAS 879514-21-3 is the registry number for 8-(Nitromethyl)-1,4-dioxaspiro[4.5]decan-8-ol, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g, 5g.
8-(nitromethyl)-1,4-dioxaspiro[4.5]decan-8-ol (CAS 879514-21-3) is a chemical compound with the molecular formula C9H15NO5 and a molecular weight of 217.22 g/mol. IUPAC name: 8-(nitromethyl)-1,4-dioxaspiro[4.5]decan-8-ol. InChIKey: HUDVAVREBBQAOY-UHFFFAOYSA-N.
| Molecular formula | C9H15NO5 |
|---|---|
| Molecular weight | 217.22 g/mol |
| IUPAC name | 8-(nitromethyl)-1,4-dioxaspiro[4.5]decan-8-ol |
| InChIKey | HUDVAVREBBQAOY-UHFFFAOYSA-N |
| SMILES | C1CC2(CCC1(C[N+](=O)[O-])O)OCCO2 |
Computed by PubChem (NCBI)