CAS 1366396-42-0 appears in our catalog under these names: 2-Oxa-6-azaspiro[3.5]nonane oxalate, 95%, 2-Oxa-6-azaspiro(3.5)nonane oxalate, 97%, 2–Oxa–6–azaspiro(3·5)nonane oxalate, 2-OXA-6-AZASPIRO[3.5]NONANE HEMIOXALATE, 97%. Offered by: Combi-blocks, AmBeed, GLPBio, Fluorochem. Available pack sizes: 250mg, 1g, 100mg, 5g.
2-oxa-8-azaspiro[3.5]nonane;oxalic acid (CAS 1366396-42-0) is a chemical compound with the molecular formula C9H15NO5 and a molecular weight of 217.22 g/mol. IUPAC name: 2-oxa-8-azaspiro[3.5]nonane;oxalic acid. InChIKey: SVFOFCAQNSCVES-UHFFFAOYSA-N.
| Molecular formula | C9H15NO5 |
|---|---|
| Molecular weight | 217.22 g/mol |
| IUPAC name | 2-oxa-8-azaspiro[3.5]nonane;oxalic acid |
| InChIKey | SVFOFCAQNSCVES-UHFFFAOYSA-N |
| SMILES | C1CC2(CNC1)COC2.C(=O)(C(=O)O)O |
Computed by PubChem (NCBI)