cas: 260555-43-9 — see every product listed under this CAS number, including other names
5-Oxo-1-(4-phenoxy-phenyl)-pyrrolidine-3-carboxylic acid, 98% (CAS 260555-43-9) is a chemical reagent available from Chemat. Available pack sizes: 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F015757-1G |
| cas | 260555-43-9 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 4095.45 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
5-oxo-1-(4-phenoxyphenyl)pyrrolidine-3-carboxylic acid (CAS 260555-43-9) is a chemical compound with the molecular formula C17H15NO4 and a molecular weight of 297.30 g/mol. IUPAC name: 5-oxo-1-(4-phenoxyphenyl)pyrrolidine-3-carboxylic acid. InChIKey: TWESYTWUFWEEIU-UHFFFAOYSA-N.
| Molecular formula | C17H15NO4 |
|---|---|
| Molecular weight | 297.30 g/mol |
| IUPAC name | 5-oxo-1-(4-phenoxyphenyl)pyrrolidine-3-carboxylic acid |
| InChIKey | TWESYTWUFWEEIU-UHFFFAOYSA-N |
| SMILES | C1C(CN(C1=O)C2=CC=C(C=C2)OC3=CC=CC=C3)C(=O)O |
Computed by PubChem (NCBI)