cas: 119-18-6 — see every product listed under this CAS number, including other names
5-Oxo-1-phenyl-4,5-dihydro-1H-pyrazole-3-carboxylic acid, 95% (CAS 119-18-6) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F029027-5G |
| cas | 119-18-6 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 5g | 128.10 Pln | |
| Fluorochem | 25g | 268.67 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
5-oxo-1-phenyl-4H-pyrazole-3-carboxylic acid (CAS 119-18-6) is a chemical compound with the molecular formula C10H8N2O3 and a molecular weight of 204.18 g/mol. IUPAC name: 5-oxo-1-phenyl-4H-pyrazole-3-carboxylic acid. InChIKey: IMZSHPUSPMOODC-UHFFFAOYSA-N.
| Molecular formula | C10H8N2O3 |
|---|---|
| Molecular weight | 204.18 g/mol |
| IUPAC name | 5-oxo-1-phenyl-4H-pyrazole-3-carboxylic acid |
| InChIKey | IMZSHPUSPMOODC-UHFFFAOYSA-N |
| SMILES | C1C(=NN(C1=O)C2=CC=CC=C2)C(=O)O |
Computed by PubChem (NCBI)