Products 1206969-75-6
CAS 1206969-75-6 is the registry number for 3-Oxo-3-(6'-methoxylcarbonylpyridin-2-yl)propanenitrile, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg, 100mg.
Methyl 6-(2-cyanoacetyl)pyridine-2-carboxylate (CAS 1206969-75-6) is a chemical compound with the molecular formula C10H8N2O3 and a molecular weight of 204.18 g/mol. IUPAC name: methyl 6-(2-cyanoacetyl)pyridine-2-carboxylate. InChIKey: MKVNIIBUDQRNHR-UHFFFAOYSA-N.
| Molecular formula | C10H8N2O3 |
|---|---|
| Molecular weight | 204.18 g/mol |
| IUPAC name | methyl 6-(2-cyanoacetyl)pyridine-2-carboxylate |
| InChIKey | MKVNIIBUDQRNHR-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC=CC(=N1)C(=O)CC#N |
Computed by PubChem (NCBI)