CAS 72856-73-6 appears in our catalog under these names: 2-Methoxy-4-(methylthio)benzoic acid, 95%, 2-Methoxy-4-(methylsulfanyl)benzoic acid, 2-Methoxy-4-(methylthio)benzoic acid 97%, 2-Methoxy-4-(methylthio)benzoic acid, 97%, 97%. Offered by: Combi-blocks, Biosynth, Ambeed, Chemat. Available pack sizes: 5g, 250mg, 100mg, 1g, 0,5g.
2-methoxy-4-methylsulfanylbenzoic acid (CAS 72856-73-6) is a chemical compound with the molecular formula C9H10O3S and a molecular weight of 198.24 g/mol. IUPAC name: 2-methoxy-4-methylsulfanylbenzoic acid. InChIKey: UOPCPHJGGRTYNC-UHFFFAOYSA-N.
| Molecular formula | C9H10O3S |
|---|---|
| Molecular weight | 198.24 g/mol |
| IUPAC name | 2-methoxy-4-methylsulfanylbenzoic acid |
| InChIKey | UOPCPHJGGRTYNC-UHFFFAOYSA-N |
| SMILES | COC1=C(C=CC(=C1)SC)C(=O)O |
Computed by PubChem (NCBI)