CAS 62521-48-6 appears in our catalog under these names: 3-Hydroxy-3-methyl-2,3-dihydrobenzothiophene 1,1-dioxide, 95%, 3-Hydroxy-3-methyl-2,3-dihydrobenzothiophene 1,1-Dioxide, ≥97%, ≥97%. Offered by: Combi-blocks, Chemat. Available pack sizes: 1g, 250mg.
3-methyl-1,1-dioxo-2H-1-benzothiophen-3-ol (CAS 62521-48-6) is a chemical compound with the molecular formula C9H10O3S and a molecular weight of 198.24 g/mol. IUPAC name: 3-methyl-1,1-dioxo-2H-1-benzothiophen-3-ol. InChIKey: FFPSODOPRLCEAD-UHFFFAOYSA-N.
| Molecular formula | C9H10O3S |
|---|---|
| Molecular weight | 198.24 g/mol |
| IUPAC name | 3-methyl-1,1-dioxo-2H-1-benzothiophen-3-ol |
| InChIKey | FFPSODOPRLCEAD-UHFFFAOYSA-N |
| SMILES | CC1(CS(=O)(=O)C2=CC=CC=C21)O |
Computed by PubChem (NCBI)