cas: 2002-03-1 — see every product listed under this CAS number, including other names
5-Phenyl-1,3,4-thiadiazol-2-amine 97% (CAS 2002-03-1) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A484195-1g |
| cas | 2002-03-1 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 159.00 Pln | |
| Ambeed | 5g | 331.44 Pln | |
| Ambeed | 10g | 464.94 Pln | |
| Ambeed | 25g | 854.31 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A484195 |
5-phenyl-1,3,4-thiadiazol-2-amine (CAS 2002-03-1) is a chemical compound with the molecular formula C8H7N3S and a molecular weight of 177.23 g/mol. IUPAC name: 5-phenyl-1,3,4-thiadiazol-2-amine. InChIKey: UHZHEOAEJRHUBW-UHFFFAOYSA-N.
| Molecular formula | C8H7N3S |
|---|---|
| Molecular weight | 177.23 g/mol |
| IUPAC name | 5-phenyl-1,3,4-thiadiazol-2-amine |
| InChIKey | UHZHEOAEJRHUBW-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NN=C(S2)N |
Computed by PubChem (NCBI)