cas: 3414-94-6 — see every product listed under this CAS number, including other names
5-Phenyl-1H-1,2,4-triazole-3-thiol 98% (CAS 3414-94-6) is a chemical reagent available from Chemat. Available pack sizes: 25g, 250mg, 1g, 5g, 10g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A785697-25g |
| cas | 3414-94-6 |
| size | 25g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 25g | 2233.81 Pln | |
| Ambeed | 250mg | 175.69 Pln | |
| Ambeed | 1g | 259.12 Pln | |
| Ambeed | 5g | 826.50 Pln | |
| Ambeed | 10g | 1366.06 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A785697 |
5-phenyl-1,2-dihydro-1,2,4-triazole-3-thione (CAS 3414-94-6) is a chemical compound with the molecular formula C8H7N3S and a molecular weight of 177.23 g/mol. IUPAC name: 5-phenyl-1,2-dihydro-1,2,4-triazole-3-thione. InChIKey: JRLMMJNORORYPO-UHFFFAOYSA-N.
| Molecular formula | C8H7N3S |
|---|---|
| Molecular weight | 177.23 g/mol |
| IUPAC name | 5-phenyl-1,2-dihydro-1,2,4-triazole-3-thione |
| InChIKey | JRLMMJNORORYPO-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NC(=S)NN2 |
Computed by PubChem (NCBI)