cas: 185316-58-9 — see every product listed under this CAS number, including other names
5-Phenyl-1h-indazole, 98% (CAS 185316-58-9) is a chemical reagent available from Chemat. Available pack sizes: 1g, 10g, 5g, 250mg, 100mg. Offered by: Combi-blocks, Fluorochem.
| brand | Combi-blocks |
|---|---|
| catalog number | QB-6985-1g |
| cas | 185316-58-9 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Combi-blocks | 1g | price on request | |
| Combi-blocks | 10g | price on request | |
| Combi-blocks | 5g | price on request | |
| Combi-blocks | 250mg | price on request | |
| Fluorochem | 100mg | 539.41 Pln | |
| Fluorochem | 250mg | 830.98 Pln | |
| Fluorochem | 1g | 1882.69 Pln | |
| Fluorochem | 100mg | 445.69 Pln | |
| Fluorochem | 250mg | 690.40 Pln | |
| Fluorochem | 1g | 1476.58 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks (only if in stock, to check click on availability) |
5-phenyl-1H-indazole (CAS 185316-58-9) is a chemical compound with the molecular formula C13H10N2 and a molecular weight of 194.23 g/mol. IUPAC name: 5-phenyl-1H-indazole. InChIKey: JQHTYMOOIFVIJV-UHFFFAOYSA-N.
| Molecular formula | C13H10N2 |
|---|---|
| Molecular weight | 194.23 g/mol |
| IUPAC name | 5-phenyl-1H-indazole |
| InChIKey | JQHTYMOOIFVIJV-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC3=C(C=C2)NN=C3 |
Computed by PubChem (NCBI)