5-Phenylpyridin-2-ol, 98%
cas: 76053-45-7 — see every product listed under this CAS number, including other names
5-Phenylpyridin-2-ol, 98% (CAS 76053-45-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Ambeed, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A197737-100mg |
| cas | 76053-45-7 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 186.81 Pln | |
| Ambeed | 250mg | 253.56 Pln | |
| Ambeed | 1g | 598.44 Pln | |
| Ambeed | 5g | 2239.38 Pln | |
| Ambeed | 10g | 3963.75 Pln | |
| BLDpharm | 250mg | 286.59 Pln | |
| BLDpharm | 1g | 697.56 Pln | |
| BLDpharm | 5g | 2641.32 Pln | |
| BLDpharm | 25g | 10566.30 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
5-phenyl-1H-pyridin-2-one (CAS 76053-45-7) is a chemical compound with the molecular formula C11H9NO and a molecular weight of 171.19 g/mol. IUPAC name: 5-phenyl-1H-pyridin-2-one. InChIKey: RWFAQYWIBBVEBY-UHFFFAOYSA-N.
| Molecular formula | C11H9NO |
|---|---|
| Molecular weight | 171.19 g/mol |
| IUPAC name | 5-phenyl-1H-pyridin-2-one |
| InChIKey | RWFAQYWIBBVEBY-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CNC(=O)C=C2 |
Computed by PubChem (NCBI)
