cas: 90565-74-5 — see every product listed under this CAS number, including other names
6,6-Dimethyl-1,3-diazaspiro(4.4)nonane-2,4-dione, 95% (CAS 90565-74-5) is a chemical reagent available from Chemat. Available pack sizes: 5g, 1g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A1066443-5g |
| cas | 90565-74-5 |
| size | 5g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 5g | 18350.08 Pln | |
| AmBeed | 1g | 7686.70 Pln |
| purity | 95% |
|---|---|
| delivery time | To be confirmed by Chemat |
9,9-dimethyl-1,3-diazaspiro[4.4]nonane-2,4-dione (CAS 90565-74-5) is a chemical compound with the molecular formula C9H14N2O2 and a molecular weight of 182.22 g/mol. IUPAC name: 9,9-dimethyl-1,3-diazaspiro[4.4]nonane-2,4-dione. InChIKey: NTIBUKKLSXENLG-UHFFFAOYSA-N.
| Molecular formula | C9H14N2O2 |
|---|---|
| Molecular weight | 182.22 g/mol |
| IUPAC name | 9,9-dimethyl-1,3-diazaspiro[4.4]nonane-2,4-dione |
| InChIKey | NTIBUKKLSXENLG-UHFFFAOYSA-N |
| SMILES | CC1(CCCC12C(=O)NC(=O)N2)C |
Computed by PubChem (NCBI)