cas: 25150-27-0 — see every product listed under this CAS number, including other names
6,7-Dichlorobenzo[d]thiazol-2-amine 95% (CAS 25150-27-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A101122-100mg |
| cas | 25150-27-0 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 175.69 Pln | |
| Ambeed | 250mg | 209.06 Pln | |
| Ambeed | 1g | 620.69 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A101122 |
6,7-dichloro-1,3-benzothiazol-2-amine (CAS 25150-27-0) is a chemical compound with the molecular formula C7H4Cl2N2S and a molecular weight of 219.09 g/mol. IUPAC name: 6,7-dichloro-1,3-benzothiazol-2-amine. InChIKey: YKHFWFMWXBZUHK-UHFFFAOYSA-N.
| Molecular formula | C7H4Cl2N2S |
|---|---|
| Molecular weight | 219.09 g/mol |
| IUPAC name | 6,7-dichloro-1,3-benzothiazol-2-amine |
| InChIKey | YKHFWFMWXBZUHK-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C2=C1N=C(S2)N)Cl)Cl |
Computed by PubChem (NCBI)