CAS 7494-00-0 is the registry number for 3,5-Dichloro-4-thiocyanatoaniline, 97%. Offered by: Combi-blocks. Available pack sizes: 25g, 5g, 1g.
(4-amino-2,6-dichlorophenyl) thiocyanate (CAS 7494-00-0) is a chemical compound with the molecular formula C7H4Cl2N2S and a molecular weight of 219.09 g/mol. IUPAC name: (4-amino-2,6-dichlorophenyl) thiocyanate. InChIKey: AUQLKWHRBNNOEH-UHFFFAOYSA-N.
| Molecular formula | C7H4Cl2N2S |
|---|---|
| Molecular weight | 219.09 g/mol |
| IUPAC name | (4-amino-2,6-dichlorophenyl) thiocyanate |
| InChIKey | AUQLKWHRBNNOEH-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1Cl)SC#N)Cl)N |
Computed by PubChem (NCBI)