CAS 1849-71-4 appears in our catalog under these names: 4,5-Dichloro-1,3-benzothiazol-2-amine, 98%, 4,5-Dichloro-1,3-benzothiazol-2-amine, >95% (HPLC), 4,5-Dichloro-benzothiazol-2-ylamine. Offered by: Combi-blocks, TRC, Biosynth. Available pack sizes: 5g, 1g, 10g, 100mg, 2,5g.
4,5-dichloro-1,3-benzothiazol-2-amine (CAS 1849-71-4) is a chemical compound with the molecular formula C7H4Cl2N2S and a molecular weight of 219.09 g/mol. IUPAC name: 4,5-dichloro-1,3-benzothiazol-2-amine. InChIKey: GMOFXJZIUQGHTF-UHFFFAOYSA-N.
| Molecular formula | C7H4Cl2N2S |
|---|---|
| Molecular weight | 219.09 g/mol |
| IUPAC name | 4,5-dichloro-1,3-benzothiazol-2-amine |
| InChIKey | GMOFXJZIUQGHTF-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C2=C1SC(=N2)N)Cl)Cl |
Computed by PubChem (NCBI)