Products 7494-03-3
CAS 7494-03-3 is the registry number for 2,3-Dichloro-4-thiocyanatoaniline, 95%. Offered by: Combi-blocks. Available pack sizes: 25g, 1g, 5g.
(4-amino-2,3-dichlorophenyl) thiocyanate (CAS 7494-03-3) is a chemical compound with the molecular formula C7H4Cl2N2S and a molecular weight of 219.09 g/mol. IUPAC name: (4-amino-2,3-dichlorophenyl) thiocyanate. InChIKey: HHYXNAYEWINMOA-UHFFFAOYSA-N.
| Molecular formula | C7H4Cl2N2S |
|---|---|
| Molecular weight | 219.09 g/mol |
| IUPAC name | (4-amino-2,3-dichlorophenyl) thiocyanate |
| InChIKey | HHYXNAYEWINMOA-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1N)Cl)Cl)SC#N |
Computed by PubChem (NCBI)