CAS 24072-75-1 appears in our catalog under these names: 2-Amino-5,6-dichlorobenzothiazole, 98%, 5,6–Dichlorobenzo(d)thiazol–2–amine, 5,6-Dichlorobenzo[d]thiazol-2-amine 95%, 5,6-Dichlorobenzo[d]thiazol-2-amine, 95%, 95%, 5,6-Dichlorobenzo[d]thiazol-2-amine. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 10g, 5g, 25g, 1g, 250mg, 100mg.
5,6-dichloro-1,3-benzothiazol-2-amine (CAS 24072-75-1) is a chemical compound with the molecular formula C7H4Cl2N2S and a molecular weight of 219.09 g/mol. IUPAC name: 5,6-dichloro-1,3-benzothiazol-2-amine. InChIKey: GHKHTBMTSUEBJD-UHFFFAOYSA-N.
| Molecular formula | C7H4Cl2N2S |
|---|---|
| Molecular weight | 219.09 g/mol |
| IUPAC name | 5,6-dichloro-1,3-benzothiazol-2-amine |
| InChIKey | GHKHTBMTSUEBJD-UHFFFAOYSA-N |
| SMILES | C1=C2C(=CC(=C1Cl)Cl)SC(=N2)N |
Computed by PubChem (NCBI)