Products 1256478-41-7
CAS 1256478-41-7 appears in our catalog under these names: 6-Chloro-2-(chloromethyl)thiazolo[5,4-b]pyridine, 97%, 6-Chloro-2-(chloromethyl)thiazolo(5,4-b)pyridine, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g, 100mg, 5g.
6-chloro-2-(chloromethyl)-[1,3]thiazolo[5,4-b]pyridine (CAS 1256478-41-7) is a chemical compound with the molecular formula C7H4Cl2N2S and a molecular weight of 219.09 g/mol. IUPAC name: 6-chloro-2-(chloromethyl)-[1,3]thiazolo[5,4-b]pyridine. InChIKey: YPBUNWSZSDVNHI-UHFFFAOYSA-N.
| Molecular formula | C7H4Cl2N2S |
|---|---|
| Molecular weight | 219.09 g/mol |
| IUPAC name | 6-chloro-2-(chloromethyl)-[1,3]thiazolo[5,4-b]pyridine |
| InChIKey | YPBUNWSZSDVNHI-UHFFFAOYSA-N |
| SMILES | C1=C(C=NC2=C1N=C(S2)CCl)Cl |
Computed by PubChem (NCBI)