CAS 6958-39-0 appears in our catalog under these names: 6,7–Dichloroquinazolin–4(3H)–one, 6,7-Dichloroquinazolin-4(3H)-one, 95%, 95%. Offered by: GLPBio, Chemat. Available pack sizes: 100mg, 1g, 250mg, 5g.
6,7-dichloro-3H-quinazolin-4-one (CAS 6958-39-0) is a chemical compound with the molecular formula C8H4Cl2N2O and a molecular weight of 215.03 g/mol. IUPAC name: 6,7-dichloro-3H-quinazolin-4-one. InChIKey: UESAHLRLKCVJGK-UHFFFAOYSA-N.
| Molecular formula | C8H4Cl2N2O |
|---|---|
| Molecular weight | 215.03 g/mol |
| IUPAC name | 6,7-dichloro-3H-quinazolin-4-one |
| InChIKey | UESAHLRLKCVJGK-UHFFFAOYSA-N |
| SMILES | C1=C2C(=CC(=C1Cl)Cl)N=CNC2=O |
Computed by PubChem (NCBI)