CAS 67092-17-5 is the registry number for 2(1H)-Quinazolinone, 5,6-dichloro-, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
5,6-dichloro-1H-quinazolin-2-one (CAS 67092-17-5) is a chemical compound with the molecular formula C8H4Cl2N2O and a molecular weight of 215.03 g/mol. IUPAC name: 5,6-dichloro-1H-quinazolin-2-one. InChIKey: OXLCJCBYCLWUFO-UHFFFAOYSA-N.
| Molecular formula | C8H4Cl2N2O |
|---|---|
| Molecular weight | 215.03 g/mol |
| IUPAC name | 5,6-dichloro-1H-quinazolin-2-one |
| InChIKey | OXLCJCBYCLWUFO-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C2=C1NC(=O)N=C2)Cl)Cl |
Computed by PubChem (NCBI)