Products 26903-92-4
CAS 26903-92-4 appears in our catalog under these names: 5-Chloro-3-(4-chlorophenyl)-1,2,4-Oxadiazole, 5-Chloro-3-(4-chlorophenyl)-1,2,4-oxadiazole 95%, 5-CHLORO-3-(4-CHLOROPHENYL)-1,2,4-OXADIAZOLE, 95%, 5-Chloro-3-(4-chlorophenyl)-1,2,4-oxadiazole, 95%, 95%. Offered by: TRC, Biosynth, Ambeed, Fluorochem, Chemat. Available pack sizes: 500mg, 250mg, 2,5g, 100mg, 1g.
5-chloro-3-(4-chlorophenyl)-1,2,4-oxadiazole (CAS 26903-92-4) is a chemical compound with the molecular formula C8H4Cl2N2O and a molecular weight of 215.03 g/mol. IUPAC name: 5-chloro-3-(4-chlorophenyl)-1,2,4-oxadiazole. InChIKey: HIZWQUSHULGCOS-UHFFFAOYSA-N.
| Molecular formula | C8H4Cl2N2O |
|---|---|
| Molecular weight | 215.03 g/mol |
| IUPAC name | 5-chloro-3-(4-chlorophenyl)-1,2,4-oxadiazole |
| InChIKey | HIZWQUSHULGCOS-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=NOC(=N2)Cl)Cl |
Computed by PubChem (NCBI)