CAS 915976-99-7 is the registry number for 7,8-Dichloro-1,5-naphthyridin-2(1H)-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
7,8-dichloro-1H-1,5-naphthyridin-2-one (CAS 915976-99-7) is a chemical compound with the molecular formula C8H4Cl2N2O and a molecular weight of 215.03 g/mol. IUPAC name: 7,8-dichloro-1H-1,5-naphthyridin-2-one. InChIKey: ILHCTTKHAOHMLM-UHFFFAOYSA-N.
| Molecular formula | C8H4Cl2N2O |
|---|---|
| Molecular weight | 215.03 g/mol |
| IUPAC name | 7,8-dichloro-1H-1,5-naphthyridin-2-one |
| InChIKey | ILHCTTKHAOHMLM-UHFFFAOYSA-N |
| SMILES | C1=CC(=O)NC2=C(C(=CN=C21)Cl)Cl |
Computed by PubChem (NCBI)