CAS 863785-66-4 appears in our catalog under these names: 5,7-Dichloro-1h-[1,6]naphthyridin-4-one, 95%, 5,7-Dichloro-1,6-naphthyridin-4(1H)-one 97%, 5,7-Dichloro-1H-[1,6]naphthyridin-4-one, 97%, 5,7-Dichloro-1,6-Naphthyridin-4(1H)-One, 97%, 97%. Offered by: Combi-blocks, Ambeed, Fluorochem, Chemat. Available pack sizes: 1g, 250mg, 100mg.
5,7-dichloro-1H-1,6-naphthyridin-4-one (CAS 863785-66-4) is a chemical compound with the molecular formula C8H4Cl2N2O and a molecular weight of 215.03 g/mol. IUPAC name: 5,7-dichloro-1H-1,6-naphthyridin-4-one. InChIKey: KFJIDHGCUDTBGV-UHFFFAOYSA-N.
| Molecular formula | C8H4Cl2N2O |
|---|---|
| Molecular weight | 215.03 g/mol |
| IUPAC name | 5,7-dichloro-1H-1,6-naphthyridin-4-one |
| InChIKey | KFJIDHGCUDTBGV-UHFFFAOYSA-N |
| SMILES | C1=CNC2=CC(=NC(=C2C1=O)Cl)Cl |
Computed by PubChem (NCBI)