CAS 117890-82-1 is the registry number for 2,3-Dichloropyrido[1,2-a]pyrimidin-4-one, 96%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
2,3-dichloropyrido[1,2-a]pyrimidin-4-one (CAS 117890-82-1) is a chemical compound with the molecular formula C8H4Cl2N2O and a molecular weight of 215.03 g/mol. IUPAC name: 2,3-dichloropyrido[1,2-a]pyrimidin-4-one. InChIKey: ZUYGRPKKRPCWJS-UHFFFAOYSA-N.
| Molecular formula | C8H4Cl2N2O |
|---|---|
| Molecular weight | 215.03 g/mol |
| IUPAC name | 2,3-dichloropyrido[1,2-a]pyrimidin-4-one |
| InChIKey | ZUYGRPKKRPCWJS-UHFFFAOYSA-N |
| SMILES | C1=CC2=NC(=C(C(=O)N2C=C1)Cl)Cl |
Computed by PubChem (NCBI)