cas: 288399-57-5 — see every product listed under this CAS number, including other names
6,8-Dimethylchromone-2-carboxylic acid (CAS 288399-57-5) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F012040-250MG |
| cas | 288399-57-5 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 143.72 Pln | |
| Fluorochem | 1g | 299.91 Pln | |
| Fluorochem | 5g | 987.17 Pln |
| delivery time | 2-3 weeks |
|---|
6,8-dimethyl-4-oxochromene-2-carboxylic acid (CAS 288399-57-5) is a chemical compound with the molecular formula C12H10O4 and a molecular weight of 218.20 g/mol. IUPAC name: 6,8-dimethyl-4-oxochromene-2-carboxylic acid. InChIKey: PQUJCDXKEIHDCF-UHFFFAOYSA-N.
| Molecular formula | C12H10O4 |
|---|---|
| Molecular weight | 218.20 g/mol |
| IUPAC name | 6,8-dimethyl-4-oxochromene-2-carboxylic acid |
| InChIKey | PQUJCDXKEIHDCF-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C2C(=C1)C(=O)C=C(O2)C(=O)O)C |
Computed by PubChem (NCBI)